4-(methylamino)phenyl thiocyanate hydrochloride
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F391822 |
---|---|
Product Name | 4-(methylamino)phenyl thiocyanate hydrochloride |
Purity | 95.0% |
Molecular weight | 200.68 |
IUPAC Name | {[4-(methylamino)phenyl]sulfanyl}formonitrile hydrochloride |
SMILES | Cl.CNC1=CC=C(SC#N)C=C1 |
INCHI Code | InChI=1S/C8H8N2S.ClH/c1-10-7-2-4-8(5-3-7)11-6-9;/h2-5,10H,1H3;1H |
Asymmetric atoms | 0 |
LogP | 1.7434237 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.125 |
Concept Codes | Phenyl, Secondary amine, Amine (P+S+T), Sulfide, Thiocyanate, N-methyl, Hydrochloride, Cyclic, Aromatic |