8-Methylnaphthalen-1-amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F382878 |
---|---|
Product Name | 8-Methylnaphthalen-1-amine |
CAS | 130523-30-7 |
Purity | 95.0% |
Molecular weight | 157.216 |
IUPAC Name | 8-methylnaphthalen-1-amine |
SMILES | CC1=CC=CC2=CC=CC(N)=C12 |
INCHI Code | InChI=1S/C11H11N/c1-8-4-2-5-9-6-3-7-10(12)11(8)9/h2-7H,12H2,1H3 |
Asymmetric atoms | 0 |
LogP | 2.647218 |
H bond acceptors | 1 |
H bond donors | 1 |
fsp3 | 0.09090909 |
Concept Codes | Primary amine, Amine (P+S+T), Methyl, Tolyl, Naphthalene, Cyclic, Aromatic |