2,6-dimethyl-4-(methylthio)phenol
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F375389 |
---|---|
Product Name | 2,6-dimethyl-4-(methylthio)phenol |
CAS | 7379-49-9 |
Molecular weight | 168.25 |
IUPAC Name | 2,6-dimethyl-4-(methylsulfanyl)phenol |
SMILES | CSC1=CC(C)=C(O)C(C)=C1 |
INCHI Code | InChI=1S/C9H12OS/c1-6-4-8(11-3)5-7(2)9(6)10/h4-5,10H,1-3H3 |
Asymmetric atoms | 0 |
LogP | 3.3247404 |
H bond acceptors | 1 |
H bond donors | 1 |
fsp3 | 0.33333334 |
Concept Codes | Phenyl, Sulfide, Methyl, Aromatic alcohol, Tolyl, Dimethyl, Phenol, Cyclic, Aromatic |