2,2,2-trichloro-1-(3,4-dihydro-2H-pyran-5-yl)ethanone
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F374689 |
---|---|
Product Name | 2,2,2-trichloro-1-(3,4-dihydro-2H-pyran-5-yl)ethanone |
Other Names | 2,2,2-Trichloro-1-(3,4-dihydro-2h-pyran-5-yl)ethan-1-one |
CAS | 83124-87-2 |
Molecular weight | 229.48 |
IUPAC Name | 2,2,2-trichloro-1-(3,4-dihydro-2H-pyran-5-yl)ethan-1-one |
SMILES | ClC(Cl)(Cl)C(=O)C1=COCCC1 |
INCHI Code | InChI=1S/C7H7Cl3O2/c8-7(9,10)6(11)5-2-1-3-12-4-5/h4H,1-3H2 |
Asymmetric atoms | 0 |
LogP | 2.5039625 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.5714286 |
Concept Codes | Ketone, Ether, Heterocycle, Chloro, Halo, Enone, 3,4-Dihydro-2H-pyran, Cyclic |