5,5'-butane-1,4-diylbis(4-methyl-4H-1,2,4-triazole-3-thiol)
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F374383 |
---|---|
Product Name | 5,5'-butane-1,4-diylbis(4-methyl-4H-1,2,4-triazole-3-thiol) |
Other Names | 5,5'-(Butane-1,4-diyl)bis(4-methyl-2,4-dihydro-3h-1,2,4-triazole-3-thione) |
CAS | 1174861-71-2 |
Molecular weight | 284.0878 |
IUPAC Name | 4-methyl-3-[4-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)butyl]-1H-1,2,4-triazole-5-thione |
SMILES | CN1C(CCCCC2=NN=C(S)N2C)=NN=C1S |
INCHI Code | InChI=1S/C10H16N6S2/c1-15-7(11-13-9(15)17)5-3-4-6-8-12-14-10(18)16(8)2/h3-6H2,1-2H3,(H,13,17)(H,14,18) |
Asymmetric atoms | 0 |
LogP | 1.0864 |
H bond acceptors | 8 |
H bond donors | 2 |
fsp3 | 0.6 |
Concept Codes | Heterocycle, Heteroaromatic, N-methyl, Aromatic thiol, 5-Membered heteroaromatic, 5-Membered heterocycle, Cyclic, Aromatic, 1,2,4-Triazole |