5-undecyl-1,3,4-thiadiazol-2-amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F373400 |
---|---|
Product Name | 5-undecyl-1,3,4-thiadiazol-2-amine |
CAS | 100539-95-5 |
Molecular weight | 255.42 |
IUPAC Name | 5-undecyl-1,3,4-thiadiazol-2-amine |
SMILES | CCCCCCCCCCCC1=NN=C(N)S1 |
INCHI Code | InChI=1S/C13H25N3S/c1-2-3-4-5-6-7-8-9-10-11-12-15-16-13(14)17-12/h2-11H2,1H3,(H2,14,16) |
Asymmetric atoms | 0 |
LogP | 4.4283347 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.84615386 |
Concept Codes | Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), Sulfide, 5-Membered heteroaromatic, 5-Membered heterocycle, Cyclic, Aromatic, 1,3,4-Thiadiazole, Thiadiazole |