3-[(2-amino-5-benzoylphenyl)amino]cyclohex-2-en-1-one
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F373172 |
---|---|
Product Name | 3-[(2-amino-5-benzoylphenyl)amino]cyclohex-2-en-1-one |
Other Names | 3-((2-Amino-5-benzoylphenyl)amino)cyclohex-2-enone |
CAS | 1417357-06-2 |
Molecular weight | 306.365 |
IUPAC Name | 3-[(2-amino-5-benzoylphenyl)amino]cyclohex-2-en-1-one |
SMILES | NC1=C(NC2=CC(=O)CCC2)C=C(C=C1)C(=O)C1=CC=CC=C1 |
INCHI Code | InChI=1S/C19H18N2O2/c20-17-10-9-14(19(23)13-5-2-1-3-6-13)11-18(17)21-15-7-4-8-16(22)12-15/h1-3,5-6,9-12,21H,4,7-8,20H2 |
Asymmetric atoms | 0 |
LogP | 2.7239923 |
H bond acceptors | 4 |
H bond donors | 2 |
fsp3 | 0.15789473 |
Concept Codes | Phenyl, Ketone, Primary amine, Secondary amine, Amine (P+S+T), Enone, Diamine, Aniline, Cyclic, Aromatic, Benzophenone, Cyclohexene |