4-(4-isopropylphenyl)-2,5-dimethyl-3-furoic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F372683 |
---|---|
Product Name | 4-(4-isopropylphenyl)-2,5-dimethyl-3-furoic acid |
CAS | 1379811-64-9 |
Molecular weight | 258.317 |
IUPAC Name | 2,5-dimethyl-4-[4-(propan-2-yl)phenyl]furan-3-carboxylic acid |
SMILES | CC(C)C1=CC=C(C=C1)C1=C(C)OC(C)=C1C(O)=O |
INCHI Code | InChI=1S/C16H18O3/c1-9(2)12-5-7-13(8-6-12)14-10(3)19-11(4)15(14)16(17)18/h5-9H,1-4H3,(H,17,18) |
Asymmetric atoms | 0 |
LogP | 4.0624313 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.3125 |
Concept Codes | Phenyl, Carboxylic acid, Heterocycle, Heteroaromatic, Methyl, Dimethyl, 5-Membered heteroaromatic, 5-Membered heterocycle, Furan, Cyclic, Aromatic |