6-amino-2-[(2,4-dichlorophenyl)amino]pyrimidin-4(3H)-one
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F371568 |
---|---|
Product Name | 6-amino-2-[(2,4-dichlorophenyl)amino]pyrimidin-4(3H)-one |
Other Names | 6-Amino-2-((2,4-dichlorophenyl)amino)pyrimidin-4(3h)-one |
CAS | 123375-88-2 |
Molecular weight | 271.1 |
IUPAC Name | 6-amino-2-[(2,4-dichlorophenyl)amino]-3,4-dihydropyrimidin-4-one |
SMILES | NC1=CC(=O)NC(NC2=C(Cl)C=C(Cl)C=C2)=N1 |
INCHI Code | InChI=1S/C10H8Cl2N4O/c11-5-1-2-7(6(12)3-5)14-10-15-8(13)4-9(17)16-10/h1-4H,(H4,13,14,15,16,17) |
Asymmetric atoms | 0 |
LogP | 2.105505 |
H bond acceptors | 4 |
H bond donors | 3 |
fsp3 | 0.0 |
Concept Codes | Phenyl, Heterocycle, Heteroaromatic, Primary amine, Secondary amine, Amine (P+S+T), Chloro, Halo, Diamine, 1,3-Dichlorobenzene, 6-Membered heteroaromatic, 6-Membered heterocycle, Dichlorobenzene, Pyrimidine, Cyclic, Aromatic |