3-ethyl-6,7-dimethyl-4-methylene-3,4-dihydroquinazolin-2(1H)-one
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F371518 |
---|---|
Product Name | 3-ethyl-6,7-dimethyl-4-methylene-3,4-dihydroquinazolin-2(1H)-one |
CAS | 1227730-51-9 |
Molecular weight | 216.284 |
IUPAC Name | 3-ethyl-6,7-dimethyl-4-methylidene-1,2,3,4-tetrahydroquinazolin-2-one |
SMILES | CCN1C(=O)NC2=C(C=C(C)C(C)=C2)C1=C |
INCHI Code | InChI=1S/C13H16N2O/c1-5-15-10(4)11-6-8(2)9(3)7-12(11)14-13(15)16/h6-7H,4-5H2,1-3H3,(H,14,16) |
Asymmetric atoms | 0 |
LogP | 2.86078 |
H bond acceptors | 1 |
H bond donors | 1 |
fsp3 | 0.30769232 |
Concept Codes | Heterocycle, Methyl, Lactam, Tolyl, Dimethyl, 6-Membered heterocycle, Cyclic, Aromatic |