4-[(dimethylamino)methyl]benzaldehyde
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F370328 |
---|---|
Product Name | 4-[(dimethylamino)methyl]benzaldehyde |
Other Names | 4-((Dimethylamino)methyl)benzaldehyde p-dimethylaminomethylbenzaldehyde |
CAS | 36874-95-0 |
Purity | 98.0% |
Molecular weight | 163.22 |
IUPAC Name | 4-[(dimethylamino)methyl]benzaldehyde |
SMILES | CN(C)CC1=CC=C(C=O)C=C1 |
INCHI Code | InChI=1S/C10H13NO/c1-11(2)7-9-3-5-10(8-12)6-4-9/h3-6,8H,7H2,1-2H3 |
Asymmetric atoms | 0 |
LogP | 1.6271449 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.3 |
Concept Codes | Phenyl, Aldehyde, Tertiary amine, Amine (P+S+T), N-methyl, Cyclic, Aromatic, Benzaldehyde |