(2-nitrophenoxy)acetyl chloride
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F368693 |
---|---|
Product Name | (2-nitrophenoxy)acetyl chloride |
CAS | 20142-87-4 |
Purity | 95.0% |
Molecular weight | 215.59 |
IUPAC Name | 2-(2-nitrophenoxy)acetyl chloride |
SMILES | [O-][N+](=O)C1=C(OCC(Cl)=O)C=CC=C1 |
INCHI Code | InChI=1S/C8H6ClNO4/c9-8(11)5-14-7-4-2-1-3-6(7)10(12)13/h1-4H,5H2 |
Asymmetric atoms | 0 |
LogP | 1.7668717 |
H bond acceptors | 4 |
H bond donors | 0 |
fsp3 | 0.125 |
Concept Codes | Phenyl, Acyl halide, Ether, Nitro, Chloro, Halo, Acyl chloride, Nitrobenzene, Cyclic, Aromatic |