1-methyl-2-(4-methylphenyl)-2-oxoethyl 4-aminobenzoate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F368203 |
---|---|
Product Name | 1-methyl-2-(4-methylphenyl)-2-oxoethyl 4-aminobenzoate |
CAS | 1160264-13-0 |
Molecular weight | 283.327 |
IUPAC Name | 1-(4-methylphenyl)-1-oxopropan-2-yl 4-aminobenzoate |
SMILES | CC(OC(=O)C1=CC=C(N)C=C1)C(=O)C1=CC=C(C)C=C1 |
INCHI Code | InChI=1/C17H17NO3/c1-11-3-5-13(6-4-11)16(19)12(2)21-17(20)14-7-9-15(18)10-8-14/h3-10,12H,18H2,1-2H3 |
Asymmetric atoms | 1 |
LogP | 3.462205 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.1764706 |
Concept Codes | Phenyl, Ketone, Ester, Primary amine, Amine (P+S+T), Methyl, Tolyl, Amino acid ester, Aniline, Cyclic, Aromatic, Benzoate |