3-(4-aminopiperidin-1-yl)-1,3,4,5-tetrahydro-2H-1-benzazepin-2-one
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F367509 |
---|---|
Product Name | 3-(4-aminopiperidin-1-yl)-1,3,4,5-tetrahydro-2H-1-benzazepin-2-one |
Other Names | 3-(4-Aminopiperidin-1-yl)-1,3,4,5-tetrahydro-2H-benzo[b]azepin-2-one |
CAS | 1142201-82-8 |
Molecular weight | 259.353 |
IUPAC Name | 3-(4-aminopiperidin-1-yl)-2,3,4,5-tetrahydro-1H-1-benzazepin-2-one |
SMILES | NC1CCN(CC1)C1CCC2=C(NC1=O)C=CC=C2 |
INCHI Code | InChI=1/C15H21N3O/c16-12-7-9-18(10-8-12)14-6-5-11-3-1-2-4-13(11)17-15(14)19/h1-4,12,14H,5-10,16H2,(H,17,19) |
Asymmetric atoms | 1 |
LogP | 1.0100459 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.53333336 |
Concept Codes | Heterocycle, Amide, Primary amine, Tertiary amine, Amine (P+S+T), Lactam, Diamine, 6-Membered heterocycle, 7-Membered heterocycle, Piperidine, Cyclic, Aromatic |