(4-{[(4-aminobenzyl)thio]methyl}phenyl)amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F367428 |
---|---|
Product Name | (4-{[(4-aminobenzyl)thio]methyl}phenyl)amine |
Other Names | 4,4'-(Thiobis(methylene))dianiline |
CAS | 838-97-1 |
Molecular weight | 244.36 |
IUPAC Name | 4-({[(4-aminophenyl)methyl]sulfanyl}methyl)aniline |
SMILES | NC1=CC=C(CSCC2=CC=C(N)C=C2)C=C1 |
INCHI Code | InChI=1S/C14H16N2S/c15-13-5-1-11(2-6-13)9-17-10-12-3-7-14(16)8-4-12/h1-8H,9-10,15-16H2 |
Asymmetric atoms | 0 |
LogP | 2.807118 |
H bond acceptors | 2 |
H bond donors | 2 |
fsp3 | 0.14285715 |
Concept Codes | Phenyl, Primary amine, Amine (P+S+T), Sulfide, Diamine, Aniline, Cyclic, Aromatic |