N-(1-methyl-4-piperidinyl)glycine dihydrochloride
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F358972 |
---|---|
Product Name | N-(1-methyl-4-piperidinyl)glycine dihydrochloride |
CAS | 1987514-00-0 |
Purity | 95.0% |
Molecular weight | 245.14 |
IUPAC Name | 2-[(1-methylpiperidin-4-yl)amino]acetic acid dihydrochloride |
SMILES | Cl.Cl.CN1CCC(CC1)NCC(O)=O |
INCHI Code | InChI=1S/C8H16N2O2.2ClH/c1-10-4-2-7(3-5-10)9-6-8(11)12;;/h7,9H,2-6H2,1H3,(H,11,12);2*1H |
Asymmetric atoms | 0 |
LogP | -3.1832435 |
H bond acceptors | 4 |
H bond donors | 2 |
fsp3 | 0.875 |
Concept Codes | Carboxylic acid, Heterocycle, Secondary amine, Tertiary amine, Amine (P+S+T), N-methyl, Hydrochloride, Amino acid, Alpha-amino acid, Diamine, 6-Membered heterocycle, Piperidine, Cyclic |