{3-[2-(2-pyridinyl)ethoxy]phenyl}amine dihydrochloride
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F358802 |
---|---|
Product Name | {3-[2-(2-pyridinyl)ethoxy]phenyl}amine dihydrochloride |
CAS | 1049791-13-0 |
Purity | 95.0% |
Molecular weight | 287.18 |
IUPAC Name | 3-[2-(pyridin-2-yl)ethoxy]aniline dihydrochloride |
SMILES | Cl.Cl.NC1=CC=CC(OCCC2=NC=CC=C2)=C1 |
INCHI Code | InChI=1S/C13H14N2O.2ClH/c14-11-4-3-6-13(10-11)16-9-7-12-5-1-2-8-15-12;;/h1-6,8,10H,7,9,14H2;2*1H |
Asymmetric atoms | 0 |
LogP | 1.8119339 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.15384616 |
Concept Codes | Phenyl, Ether, Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), Hydrochloride, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Aniline, Cyclic, Aromatic |