1,4-diphenylbenzene
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F358289 |
---|---|
Product Name | 1,4-diphenylbenzene |
Other Names | 1,1':4',1''-Terphenyl P-TERPHENYL |
CAS | 92-94-4 |
Purity | 99.0% |
Molecular weight | 230.31 |
IUPAC Name | 4-phenyl-1,1'-biphenyl |
SMILES | C1=CC=C(C=C1)C1=CC=C(C=C1)C1=CC=CC=C1 |
INCHI Code | InChI=1S/C18H14/c1-3-7-15(8-4-1)17-11-13-18(14-12-17)16-9-5-2-6-10-16/h1-14H |
Asymmetric atoms | 0 |
LogP | 5.2676964 |
H bond acceptors | 0 |
H bond donors | 0 |
fsp3 | 0.0 |
Concept Codes | Phenyl, Cyclic, Aromatic |