5-methylthiophene-2,3-dicarboxylic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F355158 |
---|---|
Product Name | 5-methylthiophene-2,3-dicarboxylic acid |
CAS | 46029-22-5 |
Purity | 97.0% |
Molecular weight | 186.18 |
IUPAC Name | 5-methylthiophene-2,3-dicarboxylic acid |
SMILES | CC1=CC(C(O)=O)=C(S1)C(O)=O |
INCHI Code | InChI=1S/C7H6O4S/c1-3-2-4(6(8)9)5(12-3)7(10)11/h2H,1H3,(H,8,9)(H,10,11) |
Asymmetric atoms | 0 |
LogP | 1.8471538 |
H bond acceptors | 4 |
H bond donors | 2 |
fsp3 | 0.14285715 |
Concept Codes | Carboxylic acid, Heterocycle, Heteroaromatic, Sulfide, Methyl, 5-Membered heteroaromatic, 5-Membered heterocycle, Thiophene, Cyclic, Aromatic |