2-(allylthio)aniline
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F348269 |
---|---|
Product Name | 2-(allylthio)aniline |
Other Names | 2-(Prop-2-en-1-ylsulfanyl)aniline |
CAS | 77053-20-4 |
Molecular weight | 165.25 |
IUPAC Name | 2-(prop-2-en-1-ylsulfanyl)aniline |
SMILES | NC1=C(SCC=C)C=CC=C1 |
INCHI Code | InChI=1S/C9H11NS/c1-2-7-11-9-6-4-3-5-8(9)10/h2-6H,1,7,10H2 |
Asymmetric atoms | 0 |
LogP | 2.400009 |
H bond acceptors | 1 |
H bond donors | 1 |
fsp3 | 0.11111111 |
Concept Codes | Phenyl, Primary amine, Amine (P+S+T), Sulfide, Alkene, Aniline, Cyclic, Aromatic |