3-Chloro-4-(trifluoromethoxy)phenylacetic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F342946 |
---|---|
Product Name | 3-Chloro-4-(trifluoromethoxy)phenylacetic acid |
CAS | 1017779-77-9 |
Molecular weight | 254.59 |
IUPAC Name | 2-[3-chloro-4-(trifluoromethoxy)phenyl]acetic acid |
SMILES | OC(=O)CC1=CC(Cl)=C(OC(F)(F)F)C=C1 |
INCHI Code | InChI=1S/C9H6ClF3O3/c10-6-3-5(4-8(14)15)1-2-7(6)16-9(11,12)13/h1-3H,4H2,(H,14,15) |
Asymmetric atoms | 0 |
LogP | 3.6461504 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.22222222 |
Concept Codes | Phenyl, Carboxylic acid, Ether, Fluoro, Chloro, Halo, Trifluoromethyl, Trifluoromethoxy, Disubstituted (2,5)- monochlorobenzene, Monochlorobenzene, Trifluoromethoxy benzene, Cyclic, Aromatic, PFA01, PFA02, PFA03 |