Methyl 5-(((4-(tert-butyl)phenyl)sulfonyl)methyl)furan-2-carboxylate, 95%
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F341467 |
---|---|
Product Name | Methyl 5-(((4-(tert-butyl)phenyl)sulfonyl)methyl)furan-2-carboxylate, 95% |
Molecular weight | 336.4 |
IUPAC Name | methyl 5-[(4-tert-butylbenzenesulfonyl)methyl]furan-2-carboxylate |
SMILES | COC(=O)C1=CC=C(CS(=O)(=O)C2=CC=C(C=C2)C(C)(C)C)O1 |
INCHI Code | InChI=1S/C17H20O5S/c1-17(2,3)12-5-8-14(9-6-12)23(19,20)11-13-7-10-15(22-13)16(18)21-4/h5-10H,11H2,1-4H3 |
Asymmetric atoms | 0 |
LogP | 3.2189977 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.3529412 |
Concept Codes | Phenyl, Ester, Heterocycle, Heteroaromatic, Sulfone, 5-Membered heteroaromatic, 5-Membered heterocycle, Furan, Cyclic, Aromatic |