6-Amino-3-methyl-2-(methylthio)pyrimidin-4(3H)-one
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F338404 |
---|---|
Product Name | 6-Amino-3-methyl-2-(methylthio)pyrimidin-4(3H)-one |
Other Names | 6-AMINO-3-METHYL-2-METHYLSULFANYLPYRIMIDIN-4-ONE 6-Amino-2-methylthio-3-methyluracil |
CAS | 54030-56-7 |
Purity | 95.0% |
Molecular weight | 171.22 |
IUPAC Name | 6-amino-3-methyl-2-(methylsulfanyl)-3,4-dihydropyrimidin-4-one |
SMILES | CSC1=NC(N)=CC(=O)N1C |
INCHI Code | InChI=1S/C6H9N3OS/c1-9-5(10)3-4(7)8-6(9)11-2/h3H,7H2,1-2H3 |
Asymmetric atoms | 0 |
LogP | 0.5873134 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.33333334 |
Concept Codes | Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), Sulfide, N-methyl, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyrimidine, Cyclic, Aromatic |