(4-(Aminomethyl)-3-fluorophenyl)boronic acid hydrochloride
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F338232 |
---|---|
Product Name | (4-(Aminomethyl)-3-fluorophenyl)boronic acid hydrochloride |
CAS | 1072946-45-2 |
Purity | 95.0% |
Molecular weight | 205.42 |
IUPAC Name | [4-(aminomethyl)-3-fluorophenyl]boronic acid hydrochloride |
SMILES | Cl.NCC1=CC=C(C=C1F)B(O)O |
INCHI Code | InChI=1S/C7H9BFNO2.ClH/c9-7-3-6(8(11)12)2-1-5(7)4-10;/h1-3,11-12H,4,10H2;1H |
Asymmetric atoms | 0 |
LogP | 0.1935195 |
H bond acceptors | 3 |
H bond donors | 3 |
fsp3 | 0.14285715 |
Concept Codes | Phenyl, Primary amine, Amine (P+S+T), Fluoro, Halo, Hydrochloride, Boronic acid, Disubstituted (2,5)- monofluorobenzene, Monofluorobenzene, Cyclic, Aromatic, Phenylboronic acid |