(3-Fluoro-4-(methylthio)phenyl)boronic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F327593 |
---|---|
Product Name | (3-Fluoro-4-(methylthio)phenyl)boronic acid |
CAS | 221030-80-4 |
Purity | 95.0% |
Molecular weight | 186.01 |
IUPAC Name | [3-fluoro-4-(methylsulfanyl)phenyl]boronic acid |
SMILES | CSC1=CC=C(C=C1F)B(O)O |
INCHI Code | InChI=1S/C7H8BFO2S/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4,10-11H,1H3 |
Asymmetric atoms | 0 |
LogP | 2.4346 |
H bond acceptors | 2 |
H bond donors | 2 |
fsp3 | 0.14285715 |
Concept Codes | Phenyl, Sulfide, Fluoro, Halo, Boronic acid, Disubstituted (2,5)- monofluorobenzene, Monofluorobenzene, Cyclic, Aromatic, Phenylboronic acid |