2-(Phenoxymethyl)morpholine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F321391 |
---|---|
Product Name | 2-(Phenoxymethyl)morpholine |
Other Names | 2-Phenoxymethyl-morpholine |
CAS | 167273-56-5 |
Purity | 95.0% |
Molecular weight | 193.246 |
IUPAC Name | 2-(phenoxymethyl)morpholine |
SMILES | C(OC1=CC=CC=C1)C1CNCCO1 |
INCHI Code | InChI=1/C11H15NO2/c1-2-4-10(5-3-1)14-9-11-8-12-6-7-13-11/h1-5,11-12H,6-9H2 |
Asymmetric atoms | 1 |
LogP | 1.2924378 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.45454547 |
Concept Codes | Phenyl, Ether, Heterocycle, Secondary amine, Amine (P+S+T), 6-Membered heterocycle, Morpholine, Cyclic, Aromatic, 1,4-Oxazinane, Oxazinane |