5-Methyl-3-phenyl-isothiazole-4-carboxylic acid ethyl ester
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F317369 |
---|---|
Product Name | 5-Methyl-3-phenyl-isothiazole-4-carboxylic acid ethyl ester |
Purity | 95.0% |
Molecular weight | 247.31 |
IUPAC Name | ethyl 5-methyl-3-phenyl-1,2-thiazole-4-carboxylate |
SMILES | CCOC(=O)C1=C(C)SN=C1C1=CC=CC=C1 |
INCHI Code | InChI=1S/C13H13NO2S/c1-3-16-13(15)11-9(2)17-14-12(11)10-7-5-4-6-8-10/h4-8H,3H2,1-2H3 |
Asymmetric atoms | 0 |
LogP | 3.9820807 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.23076923 |
Concept Codes | Phenyl, Ester, Heterocycle, Heteroaromatic, Methyl, 5-Membered heteroaromatic, 5-Membered heterocycle, Isothiazole, Cyclic, Aromatic |