2-(4-Chloro-phenoxy)-nicotinic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F317348 |
---|---|
Product Name | 2-(4-Chloro-phenoxy)-nicotinic acid |
CAS | 51362-37-9 |
Purity | 95.0% |
Molecular weight | 249.65 |
IUPAC Name | 2-(4-chlorophenoxy)pyridine-3-carboxylic acid |
SMILES | OC(=O)C1=C(OC2=CC=C(Cl)C=C2)N=CC=C1 |
INCHI Code | InChI=1S/C12H8ClNO3/c13-8-3-5-9(6-4-8)17-11-10(12(15)16)2-1-7-14-11/h1-7H,(H,15,16) |
Asymmetric atoms | 0 |
LogP | 2.9800072 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.0 |
Concept Codes | Phenyl, Carboxylic acid, Ether, Heterocycle, Heteroaromatic, Chloro, Halo, 6-Membered heteroaromatic, 6-Membered heterocycle, Monochlorobenzene, Monosubstituted (para) monochlorobenzene, Pyridine, Cyclic, Aromatic |