4-{[(4-methylphenyl)amino]methyl}benzoic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F309959 |
---|---|
Product Name | 4-{[(4-methylphenyl)amino]methyl}benzoic acid |
CAS | 901889-84-7 |
Purity | 95.0% |
Molecular weight | 241.29 |
IUPAC Name | 4-{[(4-methylphenyl)amino]methyl}benzoic acid |
SMILES | CC1=CC=C(NCC2=CC=C(C=C2)C(O)=O)C=C1 |
INCHI Code | InChI=1S/C15H15NO2/c1-11-2-8-14(9-3-11)16-10-12-4-6-13(7-5-12)15(17)18/h2-9,16H,10H2,1H3,(H,17,18) |
Asymmetric atoms | 0 |
LogP | 2.2916873 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.13333334 |
Concept Codes | Phenyl, Carboxylic acid, Secondary amine, Amine (P+S+T), Methyl, Tolyl, Amino acid, Cyclic, Aromatic, Benzoic acid |