1-propyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F307930 |
---|---|
Product Name | 1-propyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine |
CAS | 112758-86-8 |
Purity | 95.0% |
Molecular weight | 164.252 |
IUPAC Name | 1-propyl-1H,2H,3H,4H-pyrrolo[1,2-a]pyrazine |
SMILES | CCCC1NCCN2C=CC=C12 |
INCHI Code | InChI=1/C10H16N2/c1-2-4-9-10-5-3-7-12(10)8-6-11-9/h3,5,7,9,11H,2,4,6,8H2,1H3 |
Asymmetric atoms | 1 |
LogP | 1.9672971 |
H bond acceptors | 1 |
H bond donors | 1 |
fsp3 | 0.6 |
Concept Codes | Heterocycle, Heteroaromatic, Secondary amine, Amine (P+S+T), 5-Membered heteroaromatic, 5-Membered heterocycle, 6-Membered heterocycle, Cyclic, Aromatic |