ethyl 4-(2-furyl)-2,4-dioxobutanoate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F300074 |
---|---|
Product Name | ethyl 4-(2-furyl)-2,4-dioxobutanoate |
CAS | 36983-35-4 |
Purity | 95.0% |
Molecular weight | 210.185 |
IUPAC Name | ethyl 4-(furan-2-yl)-2-hydroxy-4-oxobut-2-enoate |
SMILES | CCOC(=O)C(O)=CC(=O)C1=CC=CO1 |
INCHI Code | InChI=1S/C10H10O5/c1-2-14-10(13)8(12)6-7(11)9-4-3-5-15-9/h3-6,12H,2H2,1H3 |
Asymmetric atoms | 0 |
LogP | 0.99094903 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.2 |
Concept Codes | Ketone, Aliphatic alcohol, Ester, Heterocycle, Heteroaromatic, Alkene, 5-Membered heteroaromatic, 5-Membered heterocycle, Furan, Cyclic, Aromatic |