(R)-2-Methyl-5-(prop-1-en-2-yl)cyclohex-2-enone
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F240922 |
---|---|
Product Name | (R)-2-Methyl-5-(prop-1-en-2-yl)cyclohex-2-enone |
Other Names | (R)-(-)-Carvone (-)-Carvone |
CAS | 6485-40-1 |
Purity | 95.0% |
Molecular weight | 150.221 |
IUPAC Name | (5R)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one |
SMILES | CC(=C)[C@@H]1CC=C(C)C(=O)C1 |
INCHI Code | InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9H,1,5-6H2,2-3H3/t9-/m1/s1 |
Asymmetric atoms | 1 |
LogP | 2.5525293 |
H bond acceptors | 1 |
H bond donors | 0 |
fsp3 | 0.5 |
Concept Codes | Ketone, Chiral, Methyl, Alkene, Enone, Cyclic, Cyclohexene |