1-(2-Methoxypyridin-3-yl)ethanone
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F238259 |
---|---|
Product Name | 1-(2-Methoxypyridin-3-yl)ethanone |
CAS | 131674-40-3 |
Purity | 95.0% |
Molecular weight | 151.165 |
IUPAC Name | 1-(2-methoxypyridin-3-yl)ethan-1-one |
SMILES | COC1=NC=CC=C1C(C)=O |
INCHI Code | InChI=1S/C8H9NO2/c1-6(10)7-4-3-5-9-8(7)11-2/h3-5H,1-2H3 |
Asymmetric atoms | 0 |
LogP | 0.75000715 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.25 |
Concept Codes | Ketone, Methoxy, Ether, Heterocycle, Heteroaromatic, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Cyclic, Aromatic |