1-(2,4,6-Trihydroxyphenyl)ethanone
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F237175 |
---|---|
Product Name | 1-(2,4,6-Trihydroxyphenyl)ethanone |
Other Names | Phloracetophenone 2',4',6'-TRIHYDROXYACETOPHENONE Monoacetylphloroglucinol |
CAS | 480-66-0 |
Purity | 98.0% |
Molecular weight | 168.148 |
IUPAC Name | 1-(2,4,6-trihydroxyphenyl)ethan-1-one |
SMILES | CC(=O)C1=C(O)C=C(O)C=C1O |
INCHI Code | InChI=1S/C8H8O4/c1-4(9)8-6(11)2-5(10)3-7(8)12/h2-3,10-12H,1H3 |
Asymmetric atoms | 0 |
LogP | 1.9201974 |
H bond acceptors | 4 |
H bond donors | 3 |
fsp3 | 0.125 |
Concept Codes | Phenyl, Ketone, Aromatic alcohol, Phenol, Cyclic, Aromatic, Acetophenone |