3-Methyl-2,3-dihydro-1H-inden-1-one
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F237016 |
---|---|
Product Name | 3-Methyl-2,3-dihydro-1H-inden-1-one |
Other Names | 3-METHYL-1-INDANONE 3-Methyl-indan-1-one |
CAS | 6072-57-7 |
Purity | 95.0% |
Molecular weight | 146.189 |
IUPAC Name | 3-methyl-2,3-dihydro-1H-inden-1-one |
SMILES | CC1CC(=O)C2=CC=CC=C12 |
INCHI Code | InChI=1/C10H10O/c1-7-6-10(11)9-5-3-2-4-8(7)9/h2-5,7H,6H2,1H3 |
Asymmetric atoms | 1 |
LogP | 2.1235752 |
H bond acceptors | 1 |
H bond donors | 0 |
fsp3 | 0.3 |
Concept Codes | Ketone, Methyl, Indane, Cyclic, Aromatic |