Ethyl 1-benzyl-4-oxopyrrolidine-3-carboxylate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F236985 |
---|---|
Product Name | Ethyl 1-benzyl-4-oxopyrrolidine-3-carboxylate |
CAS | 1027-35-6 |
Purity | 95.0% |
Molecular weight | 247.294 |
IUPAC Name | ethyl 1-benzyl-4-oxopyrrolidine-3-carboxylate |
SMILES | CCOC(=O)C1CN(CC2=CC=CC=C2)CC1=O |
INCHI Code | InChI=1/C14H17NO3/c1-2-18-14(17)12-9-15(10-13(12)16)8-11-6-4-3-5-7-11/h3-7,12H,2,8-10H2,1H3 |
Asymmetric atoms | 1 |
LogP | 0.8004145 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.42857143 |
Concept Codes | Phenyl, Ketone, Ester, Heterocycle, Tertiary amine, Amine (P+S+T), NBenzyl, Amino acid ester, 5-Membered heterocycle, Pyrrolidine, Cyclic, Aromatic |