(2-(3-Methoxy-3-oxoprop-1-en-1-yl)phenyl)boronic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F236154 |
---|---|
Product Name | (2-(3-Methoxy-3-oxoprop-1-en-1-yl)phenyl)boronic acid |
CAS | 372193-68-5 |
Purity | 95.0% |
Molecular weight | 206 |
IUPAC Name | {2-[(1E)-3-methoxy-3-oxoprop-1-en-1-yl]phenyl}boronic acid |
SMILES | COC(=O)\C=C\C1=CC=CC=C1B(O)O |
INCHI Code | InChI=1S/C10H11BO4/c1-15-10(12)7-6-8-4-2-3-5-9(8)11(13)14/h2-7,13-14H,1H3/b7-6+ |
Asymmetric atoms | 0 |
LogP | 2.726 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.1 |
Concept Codes | Phenyl, Ester, Alkene, Boronic acid, Cyclic, Aromatic, Phenylboronic acid |