2-(Piperidin-3-yl)acetic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F234226 |
---|---|
Product Name | 2-(Piperidin-3-yl)acetic acid |
CAS | 74494-52-3 |
Purity | 95.0% |
Molecular weight | 143.186 |
IUPAC Name | 2-(piperidin-3-yl)acetic acid |
SMILES | OC(=O)CC1CCCNC1 |
INCHI Code | InChI=1/C7H13NO2/c9-7(10)4-6-2-1-3-8-5-6/h6,8H,1-5H2,(H,9,10) |
Asymmetric atoms | 1 |
LogP | -2.3257992 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.85714287 |
Concept Codes | Carboxylic acid, Heterocycle, Secondary amine, Amine (P+S+T), Amino acid, 6-Membered heterocycle, Piperidine, Cyclic |