(R)-3-Carboxy-2-hydroxy-N,N,N-trimethylpropan-1-aminium chloride
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F224696 |
---|---|
Product Name | (R)-3-Carboxy-2-hydroxy-N,N,N-trimethylpropan-1-aminium chloride |
CAS | 6645-46-1 |
Purity | 95.0% |
Molecular weight | 197.66 |
IUPAC Name | [(2R)-3-carboxy-2-hydroxypropyl]trimethylazanium chloride |
SMILES | [Cl-].C[N+](C)(C)C[C@H](O)CC(O)=O |
INCHI Code | InChI=1S/C7H15NO3.ClH/c1-8(2,3)5-6(9)4-7(10)11;/h6,9H,4-5H2,1-3H3;1H/t6-;/m1./s1 |
Asymmetric atoms | 1 |
LogP | -4.887506 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.85714287 |
Concept Codes | Aliphatic alcohol, Carboxylic acid, Chiral, N-methyl, Ammonium, Chloride, Chiral alcohol |