3-(4-Nitrophenyl)acrylic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F224555 |
---|---|
Product Name | 3-(4-Nitrophenyl)acrylic acid |
CAS | 619-89-6 |
Purity | 95.0% |
Molecular weight | 193.158 |
IUPAC Name | 3-(4-nitrophenyl)prop-2-enoic acid |
SMILES | OC(=O)C=CC1=CC=C(C=C1)[N+]([O-])=O |
INCHI Code | InChI=1S/C9H7NO4/c11-9(12)6-3-7-1-4-8(5-2-7)10(13)14/h1-6H,(H,11,12) |
Asymmetric atoms | 0 |
LogP | 2.0760705 |
H bond acceptors | 4 |
H bond donors | 1 |
fsp3 | 0.0 |
Concept Codes | Phenyl, Carboxylic acid, Nitro, Alkene, Nitrobenzene, Cyclic, Aromatic, Cinnamic acid |