2-(Trifluoromethyl)-D-phenylalanine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F223724 |
---|---|
Product Name | 2-(Trifluoromethyl)-D-phenylalanine |
Other Names | 2-(Trifluoromethyl)-D-phenyalanine |
CAS | 130930-49-3 |
Purity | 95.0% |
Molecular weight | 233.19 |
IUPAC Name | (2R)-2-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid |
SMILES | N[C@H](CC1=C(C=CC=C1)C(F)(F)F)C(O)=O |
INCHI Code | InChI=1S/C10H10F3NO2/c11-10(12,13)7-4-2-1-3-6(7)5-8(14)9(15)16/h1-4,8H,5,14H2,(H,15,16)/t8-/m1/s1 |
Asymmetric atoms | 1 |
LogP | -0.30714288 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.3 |
Concept Codes | Phenyl, Carboxylic acid, Primary amine, Amine (P+S+T), Fluoro, Halo, Chiral, Trifluoromethyl, Amino acid, Alpha-amino acid, Chiral amine, Chiral carboxylic acid, Monosubstituted (ortho) trifluoromethylbenzene, Cyclic, Aromatic, PFA01, PFA02 |