2,6-Di-tert-butyl-4-methylcyclohexanol
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F222662 |
---|---|
Product Name | 2,6-Di-tert-butyl-4-methylcyclohexanol |
Other Names | 2,6-Di(tert-butyl)-4-methylcyclohexan-1-ol |
CAS | 163119-16-2 |
Purity | 95.0% |
Molecular weight | 226.404 |
IUPAC Name | 2,6-di-tert-butyl-4-methylcyclohexan-1-ol |
SMILES | CC1CC(C(O)C(C1)C(C)(C)C)C(C)(C)C |
INCHI Code | InChI=1/C15H30O/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7/h10-13,16H,8-9H2,1-7H3 |
Asymmetric atoms | 2 |
LogP | 4.360928 |
H bond acceptors | 1 |
H bond donors | 1 |
fsp3 | 1 |
Concept Codes | Aliphatic alcohol, Methyl, Cyclohexane, Cyclic |