(R)-2-Chloro-1-phenylethanol
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F222641 |
---|---|
Product Name | (R)-2-Chloro-1-phenylethanol |
Other Names | (R)-(-)-2-Chloro-1-phenylethanol |
CAS | 56751-12-3 |
Purity | 95.0% |
Molecular weight | 156.61 |
IUPAC Name | (1R)-2-chloro-1-phenylethan-1-ol |
SMILES | O[C@@H](CCl)C1=CC=CC=C1 |
INCHI Code | InChI=1S/C8H9ClO/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8,10H,6H2/t8-/m0/s1 |
Asymmetric atoms | 1 |
LogP | 1.930153 |
H bond acceptors | 1 |
H bond donors | 1 |
fsp3 | 0.25 |
Concept Codes | Phenyl, Aliphatic alcohol, Chloro, Halo, Chiral, Chiral alcohol, Cyclic, Aromatic |