2-(Isopropylamino)benzonitrile
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F217155 |
---|---|
Product Name | 2-(Isopropylamino)benzonitrile |
CAS | 147531-47-3 |
Purity | 95.0% |
Molecular weight | 160.22 |
IUPAC Name | 2-[(propan-2-yl)amino]benzonitrile |
SMILES | CC(C)NC1=C(C=CC=C1)C#N |
INCHI Code | InChI=1S/C10H12N2/c1-8(2)12-10-6-4-3-5-9(10)7-11/h3-6,8,12H,1-2H3 |
Asymmetric atoms | 0 |
LogP | 2.075503 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.3 |
Concept Codes | Phenyl, Secondary amine, Amine (P+S+T), Nitrile, Cyclic, Aromatic, Benzonitrile |