2-Bromo-1-methoxy-4-methyl-3-nitrobenzene
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F215771 |
---|---|
Product Name | 2-Bromo-1-methoxy-4-methyl-3-nitrobenzene |
CAS | 860734-28-7 |
Purity | 95.0% |
Molecular weight | 246.06 |
IUPAC Name | 2-bromo-1-methoxy-4-methyl-3-nitrobenzene |
SMILES | COC1=C(Br)C(=C(C)C=C1)[N+]([O-])=O |
INCHI Code | InChI=1S/C8H8BrNO3/c1-5-3-4-6(13-2)7(9)8(5)10(11)12/h3-4H,1-2H3 |
Asymmetric atoms | 0 |
LogP | 3.0377328 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.25 |
Concept Codes | Phenyl, Methoxy, Ether, Nitro, Bromo, Halo, Methyl, Tolyl, Monobromobenzene, Nitrobenzene, Cyclic, Aromatic, Anisole, 1-Bromo-2-nitrobenzene, 1-Halo-2-nitrobenzene |