3-(Benzyloxy)-5-chloro-2-ethoxypyridine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F212377 |
---|---|
Product Name | 3-(Benzyloxy)-5-chloro-2-ethoxypyridine |
CAS | 1245563-13-6 |
Purity | 95.0% |
Molecular weight | 263.72 |
IUPAC Name | 3-(benzyloxy)-5-chloro-2-ethoxypyridine |
SMILES | CCOC1=NC=C(Cl)C=C1OCC1=CC=CC=C1 |
INCHI Code | InChI=1S/C14H14ClNO2/c1-2-17-14-13(8-12(15)9-16-14)18-10-11-6-4-3-5-7-11/h3-9H,2,10H2,1H3 |
Asymmetric atoms | 0 |
LogP | 3.720014 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.21428572 |
Concept Codes | Halopyridine, Phenyl, Ether, Heterocycle, Heteroaromatic, Chloro, Halo, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Cyclic, Aromatic, O-Benzyl |