2,6-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F211929 |
---|---|
Product Name | 2,6-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
CAS | 1004761-68-5 |
Purity | 95.0% |
Molecular weight | 247.15 |
IUPAC Name | 2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
SMILES | CC1=CC(=CC(C)=C1N)B1OC(C)(C)C(C)(C)O1 |
INCHI Code | InChI=1S/C14H22BNO2/c1-9-7-11(8-10(2)12(9)16)15-17-13(3,4)14(5,6)18-15/h7-8H,16H2,1-6H3 |
Asymmetric atoms | 0 |
LogP | 4.0516 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.5714286 |
Concept Codes | Phenyl, Primary amine, Amine (P+S+T), Methyl, Tolyl, Boronic ester, Pinacol boronate, Aniline, Cyclic, Aromatic, Phenylboronic acid ester, Phenylboronic acid pinacol ester, 1,3,2-Dioxaborolane |