[1,1'-Biphenyl]-2-ylmethanol
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F209925 |
---|---|
Product Name | [1,1'-Biphenyl]-2-ylmethanol |
Other Names | 2-BIPHENYLMETHANOL [1,1'-Biphenyl]-2-methanol [1,1-Biphenyl]-2-ylmethanol |
CAS | 2928-43-0 |
Purity | 95.0% |
Molecular weight | 184.238 |
IUPAC Name | {[1,1'-biphenyl]-2-yl}methanol |
SMILES | OCC1=C(C=CC=C1)C1=CC=CC=C1 |
INCHI Code | InChI=1S/C13H12O/c14-10-12-8-4-5-9-13(12)11-6-2-1-3-7-11/h1-9,14H,10H2 |
Asymmetric atoms | 0 |
LogP | 2.8531215 |
H bond acceptors | 1 |
H bond donors | 1 |
fsp3 | 0.07692308 |
Concept Codes | Phenyl, Aliphatic alcohol, Cyclic, Aromatic, Benzyl alcohol, Biphenyl |