(R)-2-Hydroxy-4-methylpentanoic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F208795 |
---|---|
Product Name | (R)-2-Hydroxy-4-methylpentanoic acid |
CAS | 20312-37-2 |
Purity | 95.0% |
Molecular weight | 132.159 |
IUPAC Name | (2R)-2-hydroxy-4-methylpentanoic acid |
SMILES | CC(C)C[C@@H](O)C(O)=O |
INCHI Code | InChI=1S/C6H12O3/c1-4(2)3-5(7)6(8)9/h4-5,7H,3H2,1-2H3,(H,8,9)/t5-/m1/s1 |
Asymmetric atoms | 1 |
LogP | 0.7822806 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.8333333 |
Concept Codes | Aliphatic alcohol, Carboxylic acid, Chiral, Chiral alcohol, Chiral carboxylic acid |