Ethyl 7-(4-n-Butylphenyl)-7-oxoheptanoate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F208158 |
---|---|
Product Name | Ethyl 7-(4-n-Butylphenyl)-7-oxoheptanoate |
CAS | 951888-74-7 |
Purity | 97.0% |
Molecular weight | 304.43 |
IUPAC Name | ethyl 7-(4-butylphenyl)-7-oxoheptanoate |
SMILES | CCCCC1=CC=C(C=C1)C(=O)CCCCCC(=O)OCC |
INCHI Code | InChI=1S/C19H28O3/c1-3-5-9-16-12-14-17(15-13-16)18(20)10-7-6-8-11-19(21)22-4-2/h12-15H,3-11H2,1-2H3 |
Asymmetric atoms | 0 |
LogP | 5.0392914 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.57894737 |
Concept Codes | Phenyl, Ketone, Ester, Cyclic, Aromatic |